ethyl nitroacetate


ethyl nitroacetate; nitroacetic acid ethyl ester
CAS RN:[626-35-7]
Formula:C4H7NO4; 133.10 g/mol
InChiKey:FTKASJMIPSSXBP-UHFFFAOYSA-N
SMILES:CCOC(=O)C[N+]([O-])=O
Molecular structure of ethyl nitroacetate
Density:1.199 g/mL
Molar volume:111.0 mL/mol
Refractive index:1.424
Molecular refractive power:28.33 mL/mol
Boiling point:106 °C

Isomers

(S)-3-aminocarbonyl-2-hydroxypropanoic acid
Molecular structure of (S)-3-aminocarbonyl-2-hydroxypropanoic acid
4-amino-2-hydroxy-4-oxobutanoic acid
Molecular structure of 4-amino-2-hydroxy-4-oxobutanoic acid
2-amino-2-methylmalonic acid
Molecular structure of 2-amino-2-methylmalonic acid
D-aspartic acid
Molecular structure of D-aspartic acid
DL-aspartic acid
Molecular structure of DL-aspartic acid
L-aspartic acid
Molecular structure of L-aspartic acid
2-(carboxymethylamino)acetic acid
Molecular structure of 2-(carboxymethylamino)acetic acid
ethyl nitroacetate
Molecular structure of ethyl nitroacetate
ethyl 2-nitroacetate
Molecular structure of ethyl 2-nitroacetate